C30H29FN4O — CID 30362794
N,N-dibenzyl-1-[6-(4-fluorophenyl)pyridazin-3-yl]piperidine-4-carboxamide (PubChem CID 30362794) has the molecular formula C30H29FN4O and a molecular weight of 480.59 g/mol. Its IUPAC name is N,N-dibenzyl-1-[6-(4-fluorophenyl)pyridazin-3-yl]piperidine-4-carboxamide.
| Compound Name | N,N-dibenzyl-1-[6-(4-fluorophenyl)pyridazin-3-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 30362794 |
| Molecular Formula | C30H29FN4O |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | N,N-dibenzyl-1-[6-(4-fluorophenyl)pyridazin-3-yl]piperidine-4-carboxamide |
| SMILES | O=C(C1CCN(c2ccc(-c3ccc(F)cc3)nn2)CC1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C30H29FN4O/c31-27-13-11-25(12-14-27)28-15-16-29(33-32-28)34-19-17-26(18-20-34)30(36)35(21-23-7-3-1-4-8-23)22-24-9-5-2-6-10-24/h1-16,26H,17-22H2 |
| InChIKey | AYINXUIGEXNABA-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |