C21H27FN4O2 — CID 51691180
N-(3-ethoxypropyl)-1-[6-(4-fluorophenyl)pyridazin-3-yl]piperidine-4-carboxamide (PubChem CID 51691180) has the molecular formula C21H27FN4O2 and a molecular weight of 386.47 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-1-[6-(4-fluorophenyl)pyridazin-3-yl]piperidine-4-carboxamide.
| Compound Name | N-(3-ethoxypropyl)-1-[6-(4-fluorophenyl)pyridazin-3-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 51691180 |
| Molecular Formula | C21H27FN4O2 |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | N-(3-ethoxypropyl)-1-[6-(4-fluorophenyl)pyridazin-3-yl]piperidine-4-carboxamide |
| SMILES | CCOCCCNC(=O)C1CCN(c2ccc(-c3ccc(F)cc3)nn2)CC1 |
| InChI | InChI=1S/C21H27FN4O2/c1-2-28-15-3-12-23-21(27)17-10-13-26(14-11-17)20-9-8-19(24-25-20)16-4-6-18(22)7-5-16/h4-9,17H,2-3,10-15H2,1H3,(H,23,27) |
| InChIKey | DPACTLHGKPSHKO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|