C21H28FN3O4S — CID 20943213
N-(3-ethoxypropyl)-1-[5-(4-fluorophenyl)-4-methyl-1,1-dioxo-1,2-thiazol-3-yl]piperidine-4-carboxamide (PubChem CID 20943213) has the molecular formula C21H28FN3O4S and a molecular weight of 437.54 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-1-[5-(4-fluorophenyl)-4-methyl-1,1-dioxo-1,2-thiazol-3-yl]piperidine-4-carboxamide.
| Compound Name | N-(3-ethoxypropyl)-1-[5-(4-fluorophenyl)-4-methyl-1,1-dioxo-1,2-thiazol-3-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 20943213 |
| Molecular Formula | C21H28FN3O4S |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | N-(3-ethoxypropyl)-1-[5-(4-fluorophenyl)-4-methyl-1,1-dioxo-1,2-thiazol-3-yl]piperidine-4-carboxamide |
| SMILES | CCOCCCNC(=O)C1CCN(C2=NS(=O)(=O)C(c3ccc(F)cc3)=C2C)CC1 |
| InChI | InChI=1S/C21H28FN3O4S/c1-3-29-14-4-11-23-21(26)17-9-12-25(13-10-17)20-15(2)19(30(27,28)24-20)16-5-7-18(22)8-6-16/h5-8,17H,3-4,9-14H2,1-2H3,(H,23,26) |
| InChIKey | WHIZDOTYAXUUOH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|