C25H38N4O3S — CID 20943229
N-[3-(diethylamino)propyl]-1-[4-ethyl-5-(4-methylphenyl)-1,1-dioxo-1,2-thiazol-3-yl]piperidine-4-carboxamide (PubChem CID 20943229) has the molecular formula C25H38N4O3S and a molecular weight of 474.67 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-1-[4-ethyl-5-(4-methylphenyl)-1,1-dioxo-1,2-thiazol-3-yl]piperidine-4-carboxamide.
| Compound Name | N-[3-(diethylamino)propyl]-1-[4-ethyl-5-(4-methylphenyl)-1,1-dioxo-1,2-thiazol-3-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 20943229 |
| Molecular Formula | C25H38N4O3S |
| Molecular Weight | 474.67 g/mol |
| Exact Mass | 474.27 |
| IUPAC Name | N-[3-(diethylamino)propyl]-1-[4-ethyl-5-(4-methylphenyl)-1,1-dioxo-1,2-thiazol-3-yl]piperidine-4-carboxamide |
| SMILES | CCC1=C(c2ccc(C)cc2)S(=O)(=O)N=C1N1CCC(C(=O)NCCCN(CC)CC)CC1 |
| InChI | InChI=1S/C25H38N4O3S/c1-5-22-23(20-11-9-19(4)10-12-20)33(31,32)27-24(22)29-17-13-21(14-18-29)25(30)26-15-8-16-28(6-2)7-3/h9-12,21H,5-8,13-18H2,1-4H3,(H,26,30) |
| InChIKey | VYYPQGIPNNLJHQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.67 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|