C21H30N4O4S — CID 53187001
1-(3-methoxypropyl)-3-[1-[4-methyl-5-(4-methylphenyl)-1,1-dioxo-1,2-thiazol-3-yl]piperidin-4-yl]urea (PubChem CID 53187001) has the molecular formula C21H30N4O4S and a molecular weight of 434.56 g/mol. Its IUPAC name is 1-(3-methoxypropyl)-3-[1-[4-methyl-5-(4-methylphenyl)-1,1-dioxo-1,2-thiazol-3-yl]piperidin-4-yl]urea.
| Compound Name | 1-(3-methoxypropyl)-3-[1-[4-methyl-5-(4-methylphenyl)-1,1-dioxo-1,2-thiazol-3-yl]piperidin-4-yl]urea |
|---|---|
| PubChem CID | 53187001 |
| Molecular Formula | C21H30N4O4S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 1-(3-methoxypropyl)-3-[1-[4-methyl-5-(4-methylphenyl)-1,1-dioxo-1,2-thiazol-3-yl]piperidin-4-yl]urea |
| SMILES | COCCCNC(=O)NC1CCN(C2=NS(=O)(=O)C(c3ccc(C)cc3)=C2C)CC1 |
| InChI | InChI=1S/C21H30N4O4S/c1-15-5-7-17(8-6-15)19-16(2)20(24-30(19,27)28)25-12-9-18(10-13-25)23-21(26)22-11-4-14-29-3/h5-8,18H,4,9-14H2,1-3H3,(H2,22,23,26) |
| InChIKey | IYQCBZSNPHLGLY-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|