C22H32N4O4S — CID 53186994
1-[1-[5-(3,4-dimethylphenyl)-4-methyl-1,1-dioxo-1,2-thiazol-3-yl]piperidin-4-yl]-3-(3-methoxypropyl)urea (PubChem CID 53186994) has the molecular formula C22H32N4O4S and a molecular weight of 448.59 g/mol. Its IUPAC name is 1-[1-[5-(3,4-dimethylphenyl)-4-methyl-1,1-dioxo-1,2-thiazol-3-yl]piperidin-4-yl]-3-(3-methoxypropyl)urea.
| Compound Name | 1-[1-[5-(3,4-dimethylphenyl)-4-methyl-1,1-dioxo-1,2-thiazol-3-yl]piperidin-4-yl]-3-(3-methoxypropyl)urea |
|---|---|
| PubChem CID | 53186994 |
| Molecular Formula | C22H32N4O4S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | 1-[1-[5-(3,4-dimethylphenyl)-4-methyl-1,1-dioxo-1,2-thiazol-3-yl]piperidin-4-yl]-3-(3-methoxypropyl)urea |
| SMILES | COCCCNC(=O)NC1CCN(C2=NS(=O)(=O)C(c3ccc(C)c(C)c3)=C2C)CC1 |
| InChI | InChI=1S/C22H32N4O4S/c1-15-6-7-18(14-16(15)2)20-17(3)21(25-31(20,28)29)26-11-8-19(9-12-26)24-22(27)23-10-5-13-30-4/h6-7,14,19H,5,8-13H2,1-4H3,(H2,23,24,27) |
| InChIKey | ZMGVZHLXRIJUJM-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|