C15H15N3O2 — CID 116972743
1-(6-phenylpyridazin-3-yl)pyrrolidine-3-carboxylic acid (PubChem CID 116972743) has the molecular formula C15H15N3O2 and a molecular weight of 269.30 g/mol. Its IUPAC name is 1-(6-phenylpyridazin-3-yl)pyrrolidine-3-carboxylic acid.
| Compound Name | 1-(6-phenylpyridazin-3-yl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 116972743 |
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 1-(6-phenylpyridazin-3-yl)pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCN(c2ccc(-c3ccccc3)nn2)C1 |
| InChI | InChI=1S/C15H15N3O2/c19-15(20)12-8-9-18(10-12)14-7-6-13(16-17-14)11-4-2-1-3-5-11/h1-7,12H,8-10H2,(H,19,20) |
| InChIKey | UYMGJVBXWIZHGO-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |