C21H21N3O — CID 162633912
(3S,4R)-4-phenyl-1-(6-phenylpyridazin-3-yl)piperidin-3-ol (PubChem CID 162633912) has the molecular formula C21H21N3O and a molecular weight of 331.42 g/mol. Its IUPAC name is (3S,4R)-4-phenyl-1-(6-phenylpyridazin-3-yl)piperidin-3-ol.
| Compound Name | (3S,4R)-4-phenyl-1-(6-phenylpyridazin-3-yl)piperidin-3-ol |
|---|---|
| PubChem CID | 162633912 |
| Molecular Formula | C21H21N3O |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | (3S,4R)-4-phenyl-1-(6-phenylpyridazin-3-yl)piperidin-3-ol |
| SMILES | O[C@@H]1CN(c2ccc(-c3ccccc3)nn2)CC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C21H21N3O/c25-20-15-24(14-13-18(20)16-7-3-1-4-8-16)21-12-11-19(22-23-21)17-9-5-2-6-10-17/h1-12,18,20,25H,13-15H2/t18-,20-/m1/s1 |
| InChIKey | RUNDCTBTSXLQLG-UYAOXDASSA-N |
| XLogP | 3.50 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |