C17H18N4O — CID 162630814
(3S,4R)-4-phenyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-3-ol (PubChem CID 162630814) has the molecular formula C17H18N4O and a molecular weight of 294.36 g/mol. Its IUPAC name is (3S,4R)-4-phenyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-3-ol.
| Compound Name | (3S,4R)-4-phenyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-3-ol |
|---|---|
| PubChem CID | 162630814 |
| Molecular Formula | C17H18N4O |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | (3S,4R)-4-phenyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-3-ol |
| SMILES | O[C@@H]1CN(c2nnc3ccccn23)CC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C17H18N4O/c22-15-12-20(11-9-14(15)13-6-2-1-3-7-13)17-19-18-16-8-4-5-10-21(16)17/h1-8,10,14-15,22H,9,11-12H2/t14-,15-/m1/s1 |
| InChIKey | FEIXQBDSANBMJY-HUUCEWRRSA-N |
| XLogP | 2.08 |
| TPSA | 53.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |