C22H24N4 — CID 46225105
N-benzyl-N-methyl-1-(6-phenylpyridazin-3-yl)pyrrolidin-3-amine (PubChem CID 46225105) has the molecular formula C22H24N4 and a molecular weight of 344.46 g/mol. Its IUPAC name is N-benzyl-N-methyl-1-(6-phenylpyridazin-3-yl)pyrrolidin-3-amine.
| Compound Name | N-benzyl-N-methyl-1-(6-phenylpyridazin-3-yl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 46225105 |
| Molecular Formula | C22H24N4 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | N-benzyl-N-methyl-1-(6-phenylpyridazin-3-yl)pyrrolidin-3-amine |
| SMILES | CN(Cc1ccccc1)C1CCN(c2ccc(-c3ccccc3)nn2)C1 |
| InChI | InChI=1S/C22H24N4/c1-25(16-18-8-4-2-5-9-18)20-14-15-26(17-20)22-13-12-21(23-24-22)19-10-6-3-7-11-19/h2-13,20H,14-17H2,1H3 |
| InChIKey | TVOQOQZONORGPY-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |