C19H26N4O — CID 100838546
(1S)-2-[methyl-[(3S)-1-(6-methylpyridazin-3-yl)piperidin-3-yl]amino]-1-phenylethanol (PubChem CID 100838546) has the molecular formula C19H26N4O and a molecular weight of 326.44 g/mol. Its IUPAC name is (1S)-2-[methyl-[(3S)-1-(6-methylpyridazin-3-yl)piperidin-3-yl]amino]-1-phenylethanol.
| Compound Name | (1S)-2-[methyl-[(3S)-1-(6-methylpyridazin-3-yl)piperidin-3-yl]amino]-1-phenylethanol |
|---|---|
| PubChem CID | 100838546 |
| Molecular Formula | C19H26N4O |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | (1S)-2-[methyl-[(3S)-1-(6-methylpyridazin-3-yl)piperidin-3-yl]amino]-1-phenylethanol |
| SMILES | Cc1ccc(N2CCC[C@H](N(C)C[C@@H](O)c3ccccc3)C2)nn1 |
| InChI | InChI=1S/C19H26N4O/c1-15-10-11-19(21-20-15)23-12-6-9-17(13-23)22(2)14-18(24)16-7-4-3-5-8-16/h3-5,7-8,10-11,17-18,24H,6,9,12-14H2,1-2H3/t17-,18+/m0/s1 |
| InChIKey | CRFIIWKWEHYLJG-ZWKOTPCHSA-N |
| XLogP | 2.42 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |