C19H26N4O2 — CID 98761235
(2R)-1-[[(3S)-1-(6-methylpyridazin-3-yl)piperidin-3-yl]amino]-3-phenoxypropan-2-ol (PubChem CID 98761235) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is (2R)-1-[[(3S)-1-(6-methylpyridazin-3-yl)piperidin-3-yl]amino]-3-phenoxypropan-2-ol.
| Compound Name | (2R)-1-[[(3S)-1-(6-methylpyridazin-3-yl)piperidin-3-yl]amino]-3-phenoxypropan-2-ol |
|---|---|
| PubChem CID | 98761235 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | (2R)-1-[[(3S)-1-(6-methylpyridazin-3-yl)piperidin-3-yl]amino]-3-phenoxypropan-2-ol |
| SMILES | Cc1ccc(N2CCC[C@H](NC[C@@H](O)COc3ccccc3)C2)nn1 |
| InChI | InChI=1S/C19H26N4O2/c1-15-9-10-19(22-21-15)23-11-5-6-16(13-23)20-12-17(24)14-25-18-7-3-2-4-8-18/h2-4,7-10,16-17,20,24H,5-6,11-14H2,1H3/t16-,17+/m0/s1 |
| InChIKey | YYZQPLDAKKWHFQ-DLBZAZTESA-N |
| XLogP | 1.78 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |