C18H20FN5 — CID 97186348
4-fluoro-3-[[[(3R)-1-(6-methylpyridazin-3-yl)piperidin-3-yl]amino]methyl]benzonitrile (PubChem CID 97186348) has the molecular formula C18H20FN5 and a molecular weight of 325.39 g/mol. Its IUPAC name is 4-fluoro-3-[[[(3R)-1-(6-methylpyridazin-3-yl)piperidin-3-yl]amino]methyl]benzonitrile.
| Compound Name | 4-fluoro-3-[[[(3R)-1-(6-methylpyridazin-3-yl)piperidin-3-yl]amino]methyl]benzonitrile |
|---|---|
| PubChem CID | 97186348 |
| Molecular Formula | C18H20FN5 |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | 4-fluoro-3-[[[(3R)-1-(6-methylpyridazin-3-yl)piperidin-3-yl]amino]methyl]benzonitrile |
| SMILES | Cc1ccc(N2CCC[C@@H](NCc3cc(C#N)ccc3F)C2)nn1 |
| InChI | InChI=1S/C18H20FN5/c1-13-4-7-18(23-22-13)24-8-2-3-16(12-24)21-11-15-9-14(10-20)5-6-17(15)19/h4-7,9,16,21H,2-3,8,11-12H2,1H3/t16-/m1/s1 |
| InChIKey | VGPNJOLQOIHTGB-MRXNPFEDSA-N |
| XLogP | 2.55 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |