C19H21FN4 — CID 119122036
6-[4-[(4-fluoro-3-methylphenyl)methylamino]piperidin-1-yl]pyridine-3-carbonitrile (PubChem CID 119122036) has the molecular formula C19H21FN4 and a molecular weight of 324.40 g/mol. Its IUPAC name is 6-[4-[(4-fluoro-3-methylphenyl)methylamino]piperidin-1-yl]pyridine-3-carbonitrile.
| Compound Name | 6-[4-[(4-fluoro-3-methylphenyl)methylamino]piperidin-1-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 119122036 |
| Molecular Formula | C19H21FN4 |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 6-[4-[(4-fluoro-3-methylphenyl)methylamino]piperidin-1-yl]pyridine-3-carbonitrile |
| SMILES | Cc1cc(CNC2CCN(c3ccc(C#N)cn3)CC2)ccc1F |
| InChI | InChI=1S/C19H21FN4/c1-14-10-15(2-4-18(14)20)12-22-17-6-8-24(9-7-17)19-5-3-16(11-21)13-23-19/h2-5,10,13,17,22H,6-9,12H2,1H3 |
| InChIKey | COHKIFBWBNJNMQ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 51.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |