C19H22N4 — CID 119110757
6-[4-[(2-methylphenyl)methylamino]piperidin-1-yl]pyridine-3-carbonitrile (PubChem CID 119110757) has the molecular formula C19H22N4 and a molecular weight of 306.41 g/mol. Its IUPAC name is 6-[4-[(2-methylphenyl)methylamino]piperidin-1-yl]pyridine-3-carbonitrile.
| Compound Name | 6-[4-[(2-methylphenyl)methylamino]piperidin-1-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 119110757 |
| Molecular Formula | C19H22N4 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 6-[4-[(2-methylphenyl)methylamino]piperidin-1-yl]pyridine-3-carbonitrile |
| SMILES | Cc1ccccc1CNC1CCN(c2ccc(C#N)cn2)CC1 |
| InChI | InChI=1S/C19H22N4/c1-15-4-2-3-5-17(15)14-21-18-8-10-23(11-9-18)19-7-6-16(12-20)13-22-19/h2-7,13,18,21H,8-11,14H2,1H3 |
| InChIKey | BALOCAVSNVKMEV-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 51.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |