C23H29N5 — CID 72920107
6-[4-[2-(3-phenylpyrrolidin-1-yl)ethylamino]piperidin-1-yl]pyridine-3-carbonitrile (PubChem CID 72920107) has the molecular formula C23H29N5 and a molecular weight of 375.52 g/mol. Its IUPAC name is 6-[4-[2-(3-phenylpyrrolidin-1-yl)ethylamino]piperidin-1-yl]pyridine-3-carbonitrile.
| Compound Name | 6-[4-[2-(3-phenylpyrrolidin-1-yl)ethylamino]piperidin-1-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 72920107 |
| Molecular Formula | C23H29N5 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | 6-[4-[2-(3-phenylpyrrolidin-1-yl)ethylamino]piperidin-1-yl]pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(N2CCC(NCCN3CCC(c4ccccc4)C3)CC2)nc1 |
| InChI | InChI=1S/C23H29N5/c24-16-19-6-7-23(26-17-19)28-13-9-22(10-14-28)25-11-15-27-12-8-21(18-27)20-4-2-1-3-5-20/h1-7,17,21-22,25H,8-15,18H2 |
| InChIKey | DEYGTXHHUUQKBX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 55.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |