C16H15F2N3O2 — CID 56770353
1-[6-(3,5-difluorophenyl)pyridazin-3-yl]piperidine-3-carboxylic acid (PubChem CID 56770353) has the molecular formula C16H15F2N3O2 and a molecular weight of 319.31 g/mol. Its IUPAC name is 1-[6-(3,5-difluorophenyl)pyridazin-3-yl]piperidine-3-carboxylic acid.
| Compound Name | 1-[6-(3,5-difluorophenyl)pyridazin-3-yl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 56770353 |
| Molecular Formula | C16H15F2N3O2 |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 1-[6-(3,5-difluorophenyl)pyridazin-3-yl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCCN(c2ccc(-c3cc(F)cc(F)c3)nn2)C1 |
| InChI | InChI=1S/C16H15F2N3O2/c17-12-6-11(7-13(18)8-12)14-3-4-15(20-19-14)21-5-1-2-10(9-21)16(22)23/h3-4,6-8,10H,1-2,5,9H2,(H,22,23) |
| InChIKey | VNKACALEEUZJEI-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |