C25H18F10N4O2 — CID 160615293
(3R)-1-[6-(4-fluorophenyl)pyridazin-3-yl]-4-(2,4,5-trifluorophenyl)piperidin-3-amine;1,1,1,4,4,4-hexafluorobutane-2,3-dione (PubChem CID 160615293) has the molecular formula C25H18F10N4O2 and a molecular weight of 596.43 g/mol. Its IUPAC name is (3R)-1-[6-(4-fluorophenyl)pyridazin-3-yl]-4-(2,4,5-trifluorophenyl)piperidin-3-amine;1,1,1,4,4,4-hexafluorobutane-2,3-dione.
| Compound Name | (3R)-1-[6-(4-fluorophenyl)pyridazin-3-yl]-4-(2,4,5-trifluorophenyl)piperidin-3-amine;1,1,1,4,4,4-hexafluorobutane-2,3-dione |
|---|---|
| PubChem CID | 160615293 |
| Molecular Formula | C25H18F10N4O2 |
| Molecular Weight | 596.43 g/mol |
| Exact Mass | 596.13 |
| IUPAC Name | (3R)-1-[6-(4-fluorophenyl)pyridazin-3-yl]-4-(2,4,5-trifluorophenyl)piperidin-3-amine;1,1,1,4,4,4-hexafluorobutane-2,3-dione |
| SMILES | N[C@H]1CN(c2ccc(-c3ccc(F)cc3)nn2)CCC1c1cc(F)c(F)cc1F.O=C(C(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C21H18F4N4.C4F6O2/c22-13-3-1-12(2-4-13)20-5-6-21(28-27-20)29-8-7-14(19(26)11-29)15-9-17(24)18(25)10-16(15)23;5-3(6,7)1(11)2(12)4(8,9)10/h1-6,9-10,14,19H,7-8,11,26H2;/t14?,19-;/m0./s1 |
| InChIKey | RFZXRJAVPJOQIY-XEJVECFOSA-N |
| XLogP | 5.27 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.43 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|