C23H20ClF3N4O2 — CID 87216668
benzyl-[(3R,4R)-1-(6-chloropyrimidin-4-yl)-4-(2,4,5-trifluorophenyl)piperidin-3-yl]carbamic acid (PubChem CID 87216668) has the molecular formula C23H20ClF3N4O2 and a molecular weight of 476.89 g/mol. Its IUPAC name is benzyl-[(3R,4R)-1-(6-chloropyrimidin-4-yl)-4-(2,4,5-trifluorophenyl)piperidin-3-yl]carbamic acid.
| Compound Name | benzyl-[(3R,4R)-1-(6-chloropyrimidin-4-yl)-4-(2,4,5-trifluorophenyl)piperidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 87216668 |
| Molecular Formula | C23H20ClF3N4O2 |
| Molecular Weight | 476.89 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | benzyl-[(3R,4R)-1-(6-chloropyrimidin-4-yl)-4-(2,4,5-trifluorophenyl)piperidin-3-yl]carbamic acid |
| SMILES | O=C(O)N(Cc1ccccc1)[C@H]1CN(c2cc(Cl)ncn2)CC[C@@H]1c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C23H20ClF3N4O2/c24-21-10-22(29-13-28-21)30-7-6-15(16-8-18(26)19(27)9-17(16)25)20(12-30)31(23(32)33)11-14-4-2-1-3-5-14/h1-5,8-10,13,15,20H,6-7,11-12H2,(H,32,33)/t15-,20+/m1/s1 |
| InChIKey | AOBYUAUHRWKLCF-QRWLVFNGSA-N |
| XLogP | 5.09 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.89 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|