C9H10ClN3O3 — CID 175148937
(2R)-4-(6-chloropyrimidin-4-yl)morpholine-2-carboxylic acid (PubChem CID 175148937) has the molecular formula C9H10ClN3O3 and a molecular weight of 243.65 g/mol. Its IUPAC name is (2R)-4-(6-chloropyrimidin-4-yl)morpholine-2-carboxylic acid.
| Compound Name | (2R)-4-(6-chloropyrimidin-4-yl)morpholine-2-carboxylic acid |
|---|---|
| PubChem CID | 175148937 |
| Molecular Formula | C9H10ClN3O3 |
| Molecular Weight | 243.65 g/mol |
| Exact Mass | 243.04 |
| IUPAC Name | (2R)-4-(6-chloropyrimidin-4-yl)morpholine-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1CN(c2cc(Cl)ncn2)CCO1 |
| InChI | InChI=1S/C9H10ClN3O3/c10-7-3-8(12-5-11-7)13-1-2-16-6(4-13)9(14)15/h3,5-6H,1-2,4H2,(H,14,15)/t6-/m1/s1 |
| InChIKey | GZEBFUQMGHCEPI-ZCFIWIBFSA-N |
| XLogP | 0.42 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.65 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |