C11H15ClN4O — CID 138543962
(9aS)-8-(6-chloropyrimidin-4-yl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine (PubChem CID 138543962) has the molecular formula C11H15ClN4O and a molecular weight of 254.72 g/mol. Its IUPAC name is (9aS)-8-(6-chloropyrimidin-4-yl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine.
| Compound Name | (9aS)-8-(6-chloropyrimidin-4-yl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine |
|---|---|
| PubChem CID | 138543962 |
| Molecular Formula | C11H15ClN4O |
| Molecular Weight | 254.72 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | (9aS)-8-(6-chloropyrimidin-4-yl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine |
| SMILES | Clc1cc(N2CCN3CCOC[C@@H]3C2)ncn1 |
| InChI | InChI=1S/C11H15ClN4O/c12-10-5-11(14-8-13-10)16-2-1-15-3-4-17-7-9(15)6-16/h5,8-9H,1-4,6-7H2/t9-/m0/s1 |
| InChIKey | NLGWRBIICBRRLG-VIFPVBQESA-N |
| XLogP | 0.65 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.72 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |