C12H12F3NO2 — CID 138980192
benzyl N-[(1R,2R)-2-(trifluoromethyl)cyclopropyl]carbamate (PubChem CID 138980192) has the molecular formula C12H12F3NO2 and a molecular weight of 259.23 g/mol. Its IUPAC name is benzyl N-[(1R,2R)-2-(trifluoromethyl)cyclopropyl]carbamate.
| Compound Name | benzyl N-[(1R,2R)-2-(trifluoromethyl)cyclopropyl]carbamate |
|---|---|
| PubChem CID | 138980192 |
| Molecular Formula | C12H12F3NO2 |
| Molecular Weight | 259.23 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | benzyl N-[(1R,2R)-2-(trifluoromethyl)cyclopropyl]carbamate |
| SMILES | O=C(N[C@@H]1C[C@H]1C(F)(F)F)OCc1ccccc1 |
| InChI | InChI=1S/C12H12F3NO2/c13-12(14,15)9-6-10(9)16-11(17)18-7-8-4-2-1-3-5-8/h1-5,9-10H,6-7H2,(H,16,17)/t9-,10-/m1/s1 |
| InChIKey | BVRFQBARVLEUPV-NXEZZACHSA-N |
| XLogP | 2.86 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.23 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |