C14H15F2NO2 — CID 70091222
benzyl N-(4,4-difluoro-2-bicyclo[3.1.0]hexanyl)carbamate (PubChem CID 70091222) has the molecular formula C14H15F2NO2 and a molecular weight of 267.27 g/mol. Its IUPAC name is benzyl N-(4,4-difluoro-2-bicyclo[3.1.0]hexanyl)carbamate.
| Compound Name | benzyl N-(4,4-difluoro-2-bicyclo[3.1.0]hexanyl)carbamate |
|---|---|
| PubChem CID | 70091222 |
| Molecular Formula | C14H15F2NO2 |
| Molecular Weight | 267.27 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | benzyl N-(4,4-difluoro-2-bicyclo[3.1.0]hexanyl)carbamate |
| SMILES | O=C(NC1CC(F)(F)C2CC12)OCc1ccccc1 |
| InChI | InChI=1S/C14H15F2NO2/c15-14(16)7-12(10-6-11(10)14)17-13(18)19-8-9-4-2-1-3-5-9/h1-5,10-12H,6-8H2,(H,17,18) |
| InChIKey | WZGCKGGVZIGWEJ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.27 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |