C14H17F2NO3 — CID 169260932
benzyl N-[(1S,2S)-5,5-difluoro-2-hydroxycyclohexyl]carbamate (PubChem CID 169260932) has the molecular formula C14H17F2NO3 and a molecular weight of 285.29 g/mol. Its IUPAC name is benzyl N-[(1S,2S)-5,5-difluoro-2-hydroxycyclohexyl]carbamate.
| Compound Name | benzyl N-[(1S,2S)-5,5-difluoro-2-hydroxycyclohexyl]carbamate |
|---|---|
| PubChem CID | 169260932 |
| Molecular Formula | C14H17F2NO3 |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | benzyl N-[(1S,2S)-5,5-difluoro-2-hydroxycyclohexyl]carbamate |
| SMILES | O=C(N[C@H]1CC(F)(F)CC[C@@H]1O)OCc1ccccc1 |
| InChI | InChI=1S/C14H17F2NO3/c15-14(16)7-6-12(18)11(8-14)17-13(19)20-9-10-4-2-1-3-5-10/h1-5,11-12,18H,6-9H2,(H,17,19)/t11-,12-/m0/s1 |
| InChIKey | OELTVLHDIZYZDV-RYUDHWBXSA-N |
| XLogP | 2.46 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |