C13H17N5O2 — CID 174789732
benzyl N-[(3R,4S)-3-azidopiperidin-4-yl]carbamate (PubChem CID 174789732) has the molecular formula C13H17N5O2 and a molecular weight of 275.31 g/mol. Its IUPAC name is benzyl N-[(3R,4S)-3-azidopiperidin-4-yl]carbamate.
| Compound Name | benzyl N-[(3R,4S)-3-azidopiperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 174789732 |
| Molecular Formula | C13H17N5O2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | benzyl N-[(3R,4S)-3-azidopiperidin-4-yl]carbamate |
| SMILES | [N-]=[N+]=N[C@@H]1CNCC[C@@H]1NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C13H17N5O2/c14-18-17-12-8-15-7-6-11(12)16-13(19)20-9-10-4-2-1-3-5-10/h1-5,11-12,15H,6-9H2,(H,16,19)/t11-,12+/m0/s1 |
| InChIKey | IYOJTFWXAWXRLZ-NWDGAFQWSA-N |
| XLogP | 1.95 |
| TPSA | 99.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|