C14H18N4O3 — CID 171775824
benzyl N-(3-azido-4-hydroxycyclohexyl)carbamate (PubChem CID 171775824) has the molecular formula C14H18N4O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is benzyl N-(3-azido-4-hydroxycyclohexyl)carbamate.
| Compound Name | benzyl N-(3-azido-4-hydroxycyclohexyl)carbamate |
|---|---|
| PubChem CID | 171775824 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | benzyl N-(3-azido-4-hydroxycyclohexyl)carbamate |
| SMILES | [N-]=[N+]=NC1CC(NC(=O)OCc2ccccc2)CCC1O |
| InChI | InChI=1S/C14H18N4O3/c15-18-17-12-8-11(6-7-13(12)19)16-14(20)21-9-10-4-2-1-3-5-10/h1-5,11-13,19H,6-9H2,(H,16,20) |
| InChIKey | XJYGVYQYNZUNEG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 107.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|