C28H33NO7 — CID 143473102
benzyl 2,5-dioxocyclopentane-1-carboxylate;benzyl N-(2-hydroxy-3-methylcyclohexyl)carbamate (PubChem CID 143473102) has the molecular formula C28H33NO7 and a molecular weight of 495.57 g/mol. Its IUPAC name is benzyl 2,5-dioxocyclopentane-1-carboxylate;benzyl N-(2-hydroxy-3-methylcyclohexyl)carbamate.
| Compound Name | benzyl 2,5-dioxocyclopentane-1-carboxylate;benzyl N-(2-hydroxy-3-methylcyclohexyl)carbamate |
|---|---|
| PubChem CID | 143473102 |
| Molecular Formula | C28H33NO7 |
| Molecular Weight | 495.57 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | benzyl 2,5-dioxocyclopentane-1-carboxylate;benzyl N-(2-hydroxy-3-methylcyclohexyl)carbamate |
| SMILES | CC1CCCC(NC(=O)OCc2ccccc2)C1O.O=C1CCC(=O)C1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H21NO3.C13H12O4/c1-11-6-5-9-13(14(11)17)16-15(18)19-10-12-7-3-2-4-8-12;14-10-6-7-11(15)12(10)13(16)17-8-9-4-2-1-3-5-9/h2-4,7-8,11,13-14,17H,5-6,9-10H2,1H3,(H,16,18);1-5,12H,6-8H2 |
| InChIKey | NGJLTLSWQUWNKT-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.57 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|