C13H16ClNO4 — CID 110125138
2-(2-chlorophenoxy)-N-[(1R,2R,3R)-2,3-dihydroxycyclopentyl]acetamide (PubChem CID 110125138) has the molecular formula C13H16ClNO4 and a molecular weight of 285.73 g/mol. Its IUPAC name is 2-(2-chlorophenoxy)-N-[(1R,2R,3R)-2,3-dihydroxycyclopentyl]acetamide.
| Compound Name | 2-(2-chlorophenoxy)-N-[(1R,2R,3R)-2,3-dihydroxycyclopentyl]acetamide |
|---|---|
| PubChem CID | 110125138 |
| Molecular Formula | C13H16ClNO4 |
| Molecular Weight | 285.73 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 2-(2-chlorophenoxy)-N-[(1R,2R,3R)-2,3-dihydroxycyclopentyl]acetamide |
| SMILES | O=C(COc1ccccc1Cl)N[C@@H]1CC[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H16ClNO4/c14-8-3-1-2-4-11(8)19-7-12(17)15-9-5-6-10(16)13(9)18/h1-4,9-10,13,16,18H,5-7H2,(H,15,17)/t9-,10-,13-/m1/s1 |
| InChIKey | IRKWDZCHTZVGEZ-GIPNMCIBSA-N |
| XLogP | 0.72 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.73 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |