C15H20ClNO4 — CID 110125549
2-(2-chlorophenoxy)-N-[(1R,2R,3R)-2-hydroxy-3-methoxycyclohexyl]acetamide (PubChem CID 110125549) has the molecular formula C15H20ClNO4 and a molecular weight of 313.78 g/mol. Its IUPAC name is 2-(2-chlorophenoxy)-N-[(1R,2R,3R)-2-hydroxy-3-methoxycyclohexyl]acetamide.
| Compound Name | 2-(2-chlorophenoxy)-N-[(1R,2R,3R)-2-hydroxy-3-methoxycyclohexyl]acetamide |
|---|---|
| PubChem CID | 110125549 |
| Molecular Formula | C15H20ClNO4 |
| Molecular Weight | 313.78 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 2-(2-chlorophenoxy)-N-[(1R,2R,3R)-2-hydroxy-3-methoxycyclohexyl]acetamide |
| SMILES | CO[C@@H]1CCC[C@@H](NC(=O)COc2ccccc2Cl)[C@H]1O |
| InChI | InChI=1S/C15H20ClNO4/c1-20-13-8-4-6-11(15(13)19)17-14(18)9-21-12-7-3-2-5-10(12)16/h2-3,5,7,11,13,15,19H,4,6,8-9H2,1H3,(H,17,18)/t11-,13-,15-/m1/s1 |
| InChIKey | BKMDXVMEURGDSS-UXIGCNINSA-N |
| XLogP | 1.76 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.78 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |