C14H19NO7 — CID 11162770
N-[(2S,3R,5S,6R)-2,3,4,5,6-pentahydroxycyclohexyl]-2-phenoxyacetamide (PubChem CID 11162770) has the molecular formula C14H19NO7 and a molecular weight of 313.31 g/mol. Its IUPAC name is N-[(2S,3R,5S,6R)-2,3,4,5,6-pentahydroxycyclohexyl]-2-phenoxyacetamide.
| Compound Name | N-[(2S,3R,5S,6R)-2,3,4,5,6-pentahydroxycyclohexyl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 11162770 |
| Molecular Formula | C14H19NO7 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | N-[(2S,3R,5S,6R)-2,3,4,5,6-pentahydroxycyclohexyl]-2-phenoxyacetamide |
| SMILES | O=C(COc1ccccc1)NC1[C@@H](O)[C@H](O)C(O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C14H19NO7/c16-8(6-22-7-4-2-1-3-5-7)15-9-10(17)12(19)14(21)13(20)11(9)18/h1-5,9-14,17-21H,6H2,(H,15,16)/t9?,10-,11+,12+,13-,14? |
| InChIKey | RAOVDUMJZDTHCB-BJIAHVAYSA-N |
| XLogP | -2.63 |
| TPSA | 139.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | -2.63 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |