C12H13N2O5- — CID 7027212
4-oxo-4-[2-(2-phenoxyacetyl)hydrazinyl]butanoate (PubChem CID 7027212) has the molecular formula C12H13N2O5- and a molecular weight of 265.25 g/mol. Its IUPAC name is 4-oxo-4-[2-(2-phenoxyacetyl)hydrazinyl]butanoate.
| Compound Name | 4-oxo-4-[2-(2-phenoxyacetyl)hydrazinyl]butanoate |
|---|---|
| PubChem CID | 7027212 |
| Molecular Formula | C12H13N2O5- |
| Molecular Weight | 265.25 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | 4-oxo-4-[2-(2-phenoxyacetyl)hydrazinyl]butanoate |
| SMILES | O=C([O-])CCC(=O)NNC(=O)COc1ccccc1 |
| InChI | InChI=1S/C12H14N2O5/c15-10(6-7-12(17)18)13-14-11(16)8-19-9-4-2-1-3-5-9/h1-5H,6-8H2,(H,13,15)(H,14,16)(H,17,18)/p-1 |
| InChIKey | PCJCPGOIDPCYEG-UHFFFAOYSA-M |
| XLogP | -1.26 |
| TPSA | 107.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.25 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|