C18H18N2O2 — CID 2255949
2-phenoxy-N'-[(3E)-4-phenylbuta-1,3-dien-2-yl]acetohydrazide (PubChem CID 2255949) has the molecular formula C18H18N2O2 and a molecular weight of 294.35 g/mol. Its IUPAC name is 2-phenoxy-N'-[(3E)-4-phenylbuta-1,3-dien-2-yl]acetohydrazide.
| Compound Name | 2-phenoxy-N'-[(3E)-4-phenylbuta-1,3-dien-2-yl]acetohydrazide |
|---|---|
| PubChem CID | 2255949 |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 2-phenoxy-N'-[(3E)-4-phenylbuta-1,3-dien-2-yl]acetohydrazide |
| SMILES | C=C(/C=C/c1ccccc1)NNC(=O)COc1ccccc1 |
| InChI | InChI=1S/C18H18N2O2/c1-15(12-13-16-8-4-2-5-9-16)19-20-18(21)14-22-17-10-6-3-7-11-17/h2-13,19H,1,14H2,(H,20,21)/b13-12+ |
| InChIKey | HXGQECVGZRUZFC-OUKQBFOZSA-N |
| XLogP | 2.91 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|