C25H24N2O3 — CID 4606921
N-(4-phenylbut-3-en-2-ylideneamino)-2-(4-phenylmethoxyphenoxy)acetamide (PubChem CID 4606921) has the molecular formula C25H24N2O3 and a molecular weight of 400.48 g/mol. Its IUPAC name is N-(4-phenylbut-3-en-2-ylideneamino)-2-(4-phenylmethoxyphenoxy)acetamide.
| Compound Name | N-(4-phenylbut-3-en-2-ylideneamino)-2-(4-phenylmethoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 4606921 |
| Molecular Formula | C25H24N2O3 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | N-(4-phenylbut-3-en-2-ylideneamino)-2-(4-phenylmethoxyphenoxy)acetamide |
| SMILES | CC(C=Cc1ccccc1)=NNC(=O)COc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H24N2O3/c1-20(12-13-21-8-4-2-5-9-21)26-27-25(28)19-30-24-16-14-23(15-17-24)29-18-22-10-6-3-7-11-22/h2-17H,18-19H2,1H3,(H,27,28) |
| InChIKey | CQOMAPFPNQRIBG-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|