C19H18Br2N2O2 — CID 129440342
2-(2,6-dibromo-4-methylphenoxy)-N-[[(E)-4-phenylbut-3-en-2-ylidene]amino]acetamide (PubChem CID 129440342) has the molecular formula C19H18Br2N2O2 and a molecular weight of 466.17 g/mol. Its IUPAC name is 2-(2,6-dibromo-4-methylphenoxy)-N-[[(E)-4-phenylbut-3-en-2-ylidene]amino]acetamide.
| Compound Name | 2-(2,6-dibromo-4-methylphenoxy)-N-[[(E)-4-phenylbut-3-en-2-ylidene]amino]acetamide |
|---|---|
| PubChem CID | 129440342 |
| Molecular Formula | C19H18Br2N2O2 |
| Molecular Weight | 466.17 g/mol |
| Exact Mass | 463.97 |
| IUPAC Name | 2-(2,6-dibromo-4-methylphenoxy)-N-[[(E)-4-phenylbut-3-en-2-ylidene]amino]acetamide |
| SMILES | CC(/C=C/c1ccccc1)=NNC(=O)COc1c(Br)cc(C)cc1Br |
| InChI | InChI=1S/C19H18Br2N2O2/c1-13-10-16(20)19(17(21)11-13)25-12-18(24)23-22-14(2)8-9-15-6-4-3-5-7-15/h3-11H,12H2,1-2H3,(H,23,24)/b9-8+,22-14? |
| InChIKey | RZFWFOOAYFPLFD-MLHIXWRISA-N |
| XLogP | 5.10 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.17 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|