C23H20N2O3 — CID 52700184
(E)-N-[3-(2-anilino-2-oxoethoxy)phenyl]-3-phenylprop-2-enamide (PubChem CID 52700184) has the molecular formula C23H20N2O3 and a molecular weight of 372.42 g/mol. Its IUPAC name is (E)-N-[3-(2-anilino-2-oxoethoxy)phenyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[3-(2-anilino-2-oxoethoxy)phenyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 52700184 |
| Molecular Formula | C23H20N2O3 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | (E)-N-[3-(2-anilino-2-oxoethoxy)phenyl]-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)Nc1cccc(OCC(=O)Nc2ccccc2)c1 |
| InChI | InChI=1S/C23H20N2O3/c26-22(15-14-18-8-3-1-4-9-18)25-20-12-7-13-21(16-20)28-17-23(27)24-19-10-5-2-6-11-19/h1-16H,17H2,(H,24,27)(H,25,26)/b15-14+ |
| InChIKey | DEJGJWLGTLHQMJ-CCEZHUSRSA-N |
| XLogP | 4.36 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|