C19H21NO2 — CID 17094994
(E)-N-(3-butoxyphenyl)-3-phenylprop-2-enamide (PubChem CID 17094994) has the molecular formula C19H21NO2 and a molecular weight of 295.38 g/mol. Its IUPAC name is (E)-N-(3-butoxyphenyl)-3-phenylprop-2-enamide.
| Compound Name | (E)-N-(3-butoxyphenyl)-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 17094994 |
| Molecular Formula | C19H21NO2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | (E)-N-(3-butoxyphenyl)-3-phenylprop-2-enamide |
| SMILES | CCCCOc1cccc(NC(=O)/C=C/c2ccccc2)c1 |
| InChI | InChI=1S/C19H21NO2/c1-2-3-14-22-18-11-7-10-17(15-18)20-19(21)13-12-16-8-5-4-6-9-16/h4-13,15H,2-3,14H2,1H3,(H,20,21)/b13-12+ |
| InChIKey | MMKUFONOQKKLCO-OUKQBFOZSA-N |
| XLogP | 4.52 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|