About 2-oxo-3-phenoxypropanoic acid
2-oxo-3-phenoxypropanoic acid (PubChem CID 18994126) has the molecular formula C9H8O4
and a molecular weight of 180.16 g/mol. Its IUPAC name is 2-oxo-3-phenoxypropanoic acid.
Molecular Properties
| Compound Name | 2-oxo-3-phenoxypropanoic acid |
| PubChem CID | 18994126 |
| Molecular Formula | C9H8O4 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | 2-oxo-3-phenoxypropanoic acid |
| SMILES | O=C(O)C(=O)COc1ccccc1 |
| InChI | InChI=1S/C9H8O4/c10-8(9(11)12)6-13-7-4-2-1-3-5-7/h1-5H,6H2,(H,11,12) |
| InChIKey | RSUOYCBRWUTZAO-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-oxo-3-phenoxypropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-3-phenoxypropanoic acid?
The IUPAC name of 2-oxo-3-phenoxypropanoic acid (CID 18994126) is 2-oxo-3-phenoxypropanoic acid.
What is the SMILES notation for 2-oxo-3-phenoxypropanoic acid?
The canonical SMILES for 2-oxo-3-phenoxypropanoic acid is O=C(O)C(=O)COc1ccccc1.
What is the InChIKey of 2-oxo-3-phenoxypropanoic acid?
The InChIKey is RSUOYCBRWUTZAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O4/c10-8(9(11)12)6-13-7-4-2-1-3-5-7/h1-5H,6H2,(H,11,12).
What are the key properties of 2-oxo-3-phenoxypropanoic acid?
2-oxo-3-phenoxypropanoic acid has a molecular weight of 180.16 g/mol, XLogP of 0.72, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-3-phenoxypropanoic acid is sourced from PubChem (CID 18994126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).