About 2-phenoxyacetyl isocyanate
2-phenoxyacetyl isocyanate (PubChem CID 12655631) has the molecular formula C9H7NO3
and a molecular weight of 177.16 g/mol. Its IUPAC name is 2-phenoxyacetyl isocyanate.
Molecular Properties
| Compound Name | 2-phenoxyacetyl isocyanate |
| PubChem CID | 12655631 |
| Molecular Formula | C9H7NO3 |
| Molecular Weight | 177.16 g/mol |
| Exact Mass | 177.04 |
| IUPAC Name | 2-phenoxyacetyl isocyanate |
| SMILES | O=C=NC(=O)COc1ccccc1 |
| InChI | InChI=1S/C9H7NO3/c11-7-10-9(12)6-13-8-4-2-1-3-5-8/h1-5H,6H2 |
| InChIKey | SUPAAWQDMBKXGN-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.16 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2-phenoxyacetyl isocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenoxyacetyl isocyanate?
The IUPAC name of 2-phenoxyacetyl isocyanate (CID 12655631) is 2-phenoxyacetyl isocyanate.
What is the SMILES notation for 2-phenoxyacetyl isocyanate?
The canonical SMILES for 2-phenoxyacetyl isocyanate is O=C=NC(=O)COc1ccccc1.
What is the InChIKey of 2-phenoxyacetyl isocyanate?
The InChIKey is SUPAAWQDMBKXGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO3/c11-7-10-9(12)6-13-8-4-2-1-3-5-8/h1-5H,6H2.
What are the key properties of 2-phenoxyacetyl isocyanate?
2-phenoxyacetyl isocyanate has a molecular weight of 177.16 g/mol, XLogP of 0.93, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenoxyacetyl isocyanate is sourced from PubChem (CID 12655631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).