About potassium;hydride;2-phenoxyacetamide
potassium;hydride;2-phenoxyacetamide (PubChem CID 175513799) has the molecular formula C8H10KNO2
and a molecular weight of 191.27 g/mol. Its IUPAC name is potassium;hydride;2-phenoxyacetamide.
Molecular Properties
| Compound Name | potassium;hydride;2-phenoxyacetamide |
| PubChem CID | 175513799 |
| Molecular Formula | C8H10KNO2 |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.03 |
| IUPAC Name | potassium;hydride;2-phenoxyacetamide |
| SMILES | NC(=O)COc1ccccc1.[H-].[K+] |
| InChI | InChI=1S/C8H9NO2.K.H/c9-8(10)6-11-7-4-2-1-3-5-7;;/h1-5H,6H2,(H2,9,10);;/q;+1;-1 |
| InChIKey | FVOBGPHWNFBZEG-UHFFFAOYSA-N |
| XLogP | -2.33 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze potassium;hydride;2-phenoxyacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;hydride;2-phenoxyacetamide?
The IUPAC name of potassium;hydride;2-phenoxyacetamide (CID 175513799) is potassium;hydride;2-phenoxyacetamide.
What is the SMILES notation for potassium;hydride;2-phenoxyacetamide?
The canonical SMILES for potassium;hydride;2-phenoxyacetamide is NC(=O)COc1ccccc1.[H-].[K+].
What is the InChIKey of potassium;hydride;2-phenoxyacetamide?
The InChIKey is FVOBGPHWNFBZEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2.K.H/c9-8(10)6-11-7-4-2-1-3-5-7;;/h1-5H,6H2,(H2,9,10);;/q;+1;-1.
What are the key properties of potassium;hydride;2-phenoxyacetamide?
potassium;hydride;2-phenoxyacetamide has a molecular weight of 191.27 g/mol, XLogP of -2.33, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;hydride;2-phenoxyacetamide is sourced from PubChem (CID 175513799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).