About methyl thiohypochlorite;2-phenoxyacetamide
methyl thiohypochlorite;2-phenoxyacetamide (PubChem CID 143004120) has the molecular formula C9H12ClNO2S
and a molecular weight of 233.72 g/mol. Its IUPAC name is methyl thiohypochlorite;2-phenoxyacetamide.
Molecular Properties
| Compound Name | methyl thiohypochlorite;2-phenoxyacetamide |
| PubChem CID | 143004120 |
| Molecular Formula | C9H12ClNO2S |
| Molecular Weight | 233.72 g/mol |
| Exact Mass | 233.03 |
| IUPAC Name | methyl thiohypochlorite;2-phenoxyacetamide |
| SMILES | CSCl.NC(=O)COc1ccccc1 |
| InChI | InChI=1S/C8H9NO2.CH3ClS/c9-8(10)6-11-7-4-2-1-3-5-7;1-3-2/h1-5H,6H2,(H2,9,10);1H3 |
| InChIKey | TXJBHFLYCMYMSN-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.72 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl thiohypochlorite;2-phenoxyacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl thiohypochlorite;2-phenoxyacetamide?
The IUPAC name of methyl thiohypochlorite;2-phenoxyacetamide (CID 143004120) is methyl thiohypochlorite;2-phenoxyacetamide.
What is the SMILES notation for methyl thiohypochlorite;2-phenoxyacetamide?
The canonical SMILES for methyl thiohypochlorite;2-phenoxyacetamide is CSCl.NC(=O)COc1ccccc1.
What is the InChIKey of methyl thiohypochlorite;2-phenoxyacetamide?
The InChIKey is TXJBHFLYCMYMSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2.CH3ClS/c9-8(10)6-11-7-4-2-1-3-5-7;1-3-2/h1-5H,6H2,(H2,9,10);1H3.
What are the key properties of methyl thiohypochlorite;2-phenoxyacetamide?
methyl thiohypochlorite;2-phenoxyacetamide has a molecular weight of 233.72 g/mol, XLogP of 2.05, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl thiohypochlorite;2-phenoxyacetamide is sourced from PubChem (CID 143004120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).