About chloromethane;2-phenoxyacetic acid
chloromethane;2-phenoxyacetic acid (PubChem CID 157255542) has the molecular formula C9H11ClO3
and a molecular weight of 202.64 g/mol. Its IUPAC name is chloromethane;2-phenoxyacetic acid.
Molecular Properties
| Compound Name | chloromethane;2-phenoxyacetic acid |
| PubChem CID | 157255542 |
| Molecular Formula | C9H11ClO3 |
| Molecular Weight | 202.64 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | chloromethane;2-phenoxyacetic acid |
| SMILES | CCl.O=C(O)COc1ccccc1 |
| InChI | InChI=1S/C8H8O3.CH3Cl/c9-8(10)6-11-7-4-2-1-3-5-7;1-2/h1-5H,6H2,(H,9,10);1H3 |
| InChIKey | AWVSUWFQFFHWGM-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.64 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze chloromethane;2-phenoxyacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloromethane;2-phenoxyacetic acid?
The IUPAC name of chloromethane;2-phenoxyacetic acid (CID 157255542) is chloromethane;2-phenoxyacetic acid.
What is the SMILES notation for chloromethane;2-phenoxyacetic acid?
The canonical SMILES for chloromethane;2-phenoxyacetic acid is CCl.O=C(O)COc1ccccc1.
What is the InChIKey of chloromethane;2-phenoxyacetic acid?
The InChIKey is AWVSUWFQFFHWGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O3.CH3Cl/c9-8(10)6-11-7-4-2-1-3-5-7;1-2/h1-5H,6H2,(H,9,10);1H3.
What are the key properties of chloromethane;2-phenoxyacetic acid?
chloromethane;2-phenoxyacetic acid has a molecular weight of 202.64 g/mol, XLogP of 2.01, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chloromethane;2-phenoxyacetic acid is sourced from PubChem (CID 157255542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).