C12H13NO6 — CID 175172730
1-hydroxypyrrolidine-2,5-dione;2-phenoxyacetic acid (PubChem CID 175172730) has the molecular formula C12H13NO6 and a molecular weight of 267.24 g/mol. Its IUPAC name is 1-hydroxypyrrolidine-2,5-dione;2-phenoxyacetic acid.
| Compound Name | 1-hydroxypyrrolidine-2,5-dione;2-phenoxyacetic acid |
|---|---|
| PubChem CID | 175172730 |
| Molecular Formula | C12H13NO6 |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 1-hydroxypyrrolidine-2,5-dione;2-phenoxyacetic acid |
| SMILES | O=C(O)COc1ccccc1.O=C1CCC(=O)N1O |
| InChI | InChI=1S/C8H8O3.C4H5NO3/c9-8(10)6-11-7-4-2-1-3-5-7;6-3-1-2-4(7)5(3)8/h1-5H,6H2,(H,9,10);8H,1-2H2 |
| InChIKey | AYUKRPKEWAJNTO-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|