About 2-phenoxyacetic acid;phenyl acetate
2-phenoxyacetic acid;phenyl acetate (PubChem CID 160680696) has the molecular formula C16H16O5
and a molecular weight of 288.30 g/mol. Its IUPAC name is 2-phenoxyacetic acid;phenyl acetate.
Molecular Properties
| Compound Name | 2-phenoxyacetic acid;phenyl acetate |
| PubChem CID | 160680696 |
| Molecular Formula | C16H16O5 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 2-phenoxyacetic acid;phenyl acetate |
| SMILES | CC(=O)Oc1ccccc1.O=C(O)COc1ccccc1 |
| InChI | InChI=1S/C8H8O3.C8H8O2/c9-8(10)6-11-7-4-2-1-3-5-7;1-7(9)10-8-5-3-2-4-6-8/h1-5H,6H2,(H,9,10);2-6H,1H3 |
| InChIKey | ROCHPOOKGJWUMB-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 2-phenoxyacetic acid;phenyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenoxyacetic acid;phenyl acetate?
The IUPAC name of 2-phenoxyacetic acid;phenyl acetate (CID 160680696) is 2-phenoxyacetic acid;phenyl acetate.
What is the SMILES notation for 2-phenoxyacetic acid;phenyl acetate?
The canonical SMILES for 2-phenoxyacetic acid;phenyl acetate is CC(=O)Oc1ccccc1.O=C(O)COc1ccccc1.
What is the InChIKey of 2-phenoxyacetic acid;phenyl acetate?
The InChIKey is ROCHPOOKGJWUMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O3.C8H8O2/c9-8(10)6-11-7-4-2-1-3-5-7;1-7(9)10-8-5-3-2-4-6-8/h1-5H,6H2,(H,9,10);2-6H,1H3.
What are the key properties of 2-phenoxyacetic acid;phenyl acetate?
2-phenoxyacetic acid;phenyl acetate has a molecular weight of 288.30 g/mol, XLogP of 2.76, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenoxyacetic acid;phenyl acetate is sourced from PubChem (CID 160680696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).