About diphenyl carbonate;phenyl acetate
diphenyl carbonate;phenyl acetate (PubChem CID 90936233) has the molecular formula C21H18O5
and a molecular weight of 350.37 g/mol. Its IUPAC name is diphenyl carbonate;phenyl acetate.
Molecular Properties
| Compound Name | diphenyl carbonate;phenyl acetate |
| PubChem CID | 90936233 |
| Molecular Formula | C21H18O5 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | diphenyl carbonate;phenyl acetate |
| SMILES | CC(=O)Oc1ccccc1.O=C(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C13H10O3.C8H8O2/c14-13(15-11-7-3-1-4-8-11)16-12-9-5-2-6-10-12;1-7(9)10-8-5-3-2-4-6-8/h1-10H;2-6H,1H3 |
| InChIKey | PFJCPTNPNKGTGG-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze diphenyl carbonate;phenyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenyl carbonate;phenyl acetate?
The IUPAC name of diphenyl carbonate;phenyl acetate (CID 90936233) is diphenyl carbonate;phenyl acetate.
What is the SMILES notation for diphenyl carbonate;phenyl acetate?
The canonical SMILES for diphenyl carbonate;phenyl acetate is CC(=O)Oc1ccccc1.O=C(Oc1ccccc1)Oc1ccccc1.
What is the InChIKey of diphenyl carbonate;phenyl acetate?
The InChIKey is PFJCPTNPNKGTGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O3.C8H8O2/c14-13(15-11-7-3-1-4-8-11)16-12-9-5-2-6-10-12;1-7(9)10-8-5-3-2-4-6-8/h1-10H;2-6H,1H3.
What are the key properties of diphenyl carbonate;phenyl acetate?
diphenyl carbonate;phenyl acetate has a molecular weight of 350.37 g/mol, XLogP of 4.88, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diphenyl carbonate;phenyl acetate is sourced from PubChem (CID 90936233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).