About diphenyl carbonate;ethoxyethane
diphenyl carbonate;ethoxyethane (PubChem CID 67230205) has the molecular formula C17H20O4
and a molecular weight of 288.34 g/mol. Its IUPAC name is diphenyl carbonate;ethoxyethane.
Molecular Properties
| Compound Name | diphenyl carbonate;ethoxyethane |
| PubChem CID | 67230205 |
| Molecular Formula | C17H20O4 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | diphenyl carbonate;ethoxyethane |
| SMILES | CCOCC.O=C(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C13H10O3.C4H10O/c14-13(15-11-7-3-1-4-8-11)16-12-9-5-2-6-10-12;1-3-5-4-2/h1-10H;3-4H2,1-2H3 |
| InChIKey | AWUFJAWOBNPAAK-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze diphenyl carbonate;ethoxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenyl carbonate;ethoxyethane?
The IUPAC name of diphenyl carbonate;ethoxyethane (CID 67230205) is diphenyl carbonate;ethoxyethane.
What is the SMILES notation for diphenyl carbonate;ethoxyethane?
The canonical SMILES for diphenyl carbonate;ethoxyethane is CCOCC.O=C(Oc1ccccc1)Oc1ccccc1.
What is the InChIKey of diphenyl carbonate;ethoxyethane?
The InChIKey is AWUFJAWOBNPAAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O3.C4H10O/c14-13(15-11-7-3-1-4-8-11)16-12-9-5-2-6-10-12;1-3-5-4-2/h1-10H;3-4H2,1-2H3.
What are the key properties of diphenyl carbonate;ethoxyethane?
diphenyl carbonate;ethoxyethane has a molecular weight of 288.34 g/mol, XLogP of 4.31, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diphenyl carbonate;ethoxyethane is sourced from PubChem (CID 67230205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).