About dimethyl carbonate;methyl phenyl carbonate
dimethyl carbonate;methyl phenyl carbonate (PubChem CID 70311897) has the molecular formula C11H14O6
and a molecular weight of 242.23 g/mol. Its IUPAC name is dimethyl carbonate;methyl phenyl carbonate.
Molecular Properties
| Compound Name | dimethyl carbonate;methyl phenyl carbonate |
| PubChem CID | 70311897 |
| Molecular Formula | C11H14O6 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | dimethyl carbonate;methyl phenyl carbonate |
| SMILES | COC(=O)OC.COC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C8H8O3.C3H6O3/c1-10-8(9)11-7-5-3-2-4-6-7;1-5-3(4)6-2/h2-6H,1H3;1-2H3 |
| InChIKey | DHZGCOANJILENT-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze dimethyl carbonate;methyl phenyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl carbonate;methyl phenyl carbonate?
The IUPAC name of dimethyl carbonate;methyl phenyl carbonate (CID 70311897) is dimethyl carbonate;methyl phenyl carbonate.
What is the SMILES notation for dimethyl carbonate;methyl phenyl carbonate?
The canonical SMILES for dimethyl carbonate;methyl phenyl carbonate is COC(=O)OC.COC(=O)Oc1ccccc1.
What is the InChIKey of dimethyl carbonate;methyl phenyl carbonate?
The InChIKey is DHZGCOANJILENT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O3.C3H6O3/c1-10-8(9)11-7-5-3-2-4-6-7;1-5-3(4)6-2/h2-6H,1H3;1-2H3.
What are the key properties of dimethyl carbonate;methyl phenyl carbonate?
dimethyl carbonate;methyl phenyl carbonate has a molecular weight of 242.23 g/mol, XLogP of 2.23, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl carbonate;methyl phenyl carbonate is sourced from PubChem (CID 70311897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).