About methyl (4-phenoxyphenyl) carbonate
methyl (4-phenoxyphenyl) carbonate (PubChem CID 19704468) has the molecular formula C14H12O4
and a molecular weight of 244.25 g/mol. Its IUPAC name is methyl (4-phenoxyphenyl) carbonate.
Molecular Properties
| Compound Name | methyl (4-phenoxyphenyl) carbonate |
| PubChem CID | 19704468 |
| Molecular Formula | C14H12O4 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | methyl (4-phenoxyphenyl) carbonate |
| SMILES | COC(=O)Oc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C14H12O4/c1-16-14(15)18-13-9-7-12(8-10-13)17-11-5-3-2-4-6-11/h2-10H,1H3 |
| InChIKey | GHGXVCDBNIJKGT-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze methyl (4-phenoxyphenyl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (4-phenoxyphenyl) carbonate?
The IUPAC name of methyl (4-phenoxyphenyl) carbonate (CID 19704468) is methyl (4-phenoxyphenyl) carbonate.
What is the SMILES notation for methyl (4-phenoxyphenyl) carbonate?
The canonical SMILES for methyl (4-phenoxyphenyl) carbonate is COC(=O)Oc1ccc(Oc2ccccc2)cc1.
What is the InChIKey of methyl (4-phenoxyphenyl) carbonate?
The InChIKey is GHGXVCDBNIJKGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O4/c1-16-14(15)18-13-9-7-12(8-10-13)17-11-5-3-2-4-6-11/h2-10H,1H3.
What are the key properties of methyl (4-phenoxyphenyl) carbonate?
methyl (4-phenoxyphenyl) carbonate has a molecular weight of 244.25 g/mol, XLogP of 3.62, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (4-phenoxyphenyl) carbonate is sourced from PubChem (CID 19704468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).