C22H22O7 — CID 144731542
4-O-(4-methoxycarbonyloxyphenyl) 1-O-phenyl cyclohexane-1,4-dicarboxylate (PubChem CID 144731542) has the molecular formula C22H22O7 and a molecular weight of 398.41 g/mol. Its IUPAC name is 4-O-(4-methoxycarbonyloxyphenyl) 1-O-phenyl cyclohexane-1,4-dicarboxylate.
| Compound Name | 4-O-(4-methoxycarbonyloxyphenyl) 1-O-phenyl cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 144731542 |
| Molecular Formula | C22H22O7 |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 4-O-(4-methoxycarbonyloxyphenyl) 1-O-phenyl cyclohexane-1,4-dicarboxylate |
| SMILES | COC(=O)Oc1ccc(OC(=O)C2CCC(C(=O)Oc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C22H22O7/c1-26-22(25)29-19-13-11-18(12-14-19)28-21(24)16-9-7-15(8-10-16)20(23)27-17-5-3-2-4-6-17/h2-6,11-16H,7-10H2,1H3 |
| InChIKey | LYLSPNPWHZRAMK-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|