About [2-(2-ethoxyethoxy)-1-phenylethyl] phenyl carbonate
[2-(2-ethoxyethoxy)-1-phenylethyl] phenyl carbonate (PubChem CID 118088751) has the molecular formula C19H22O5
and a molecular weight of 330.38 g/mol. Its IUPAC name is [2-(2-ethoxyethoxy)-1-phenylethyl] phenyl carbonate.
Molecular Properties
| Compound Name | [2-(2-ethoxyethoxy)-1-phenylethyl] phenyl carbonate |
| PubChem CID | 118088751 |
| Molecular Formula | C19H22O5 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | [2-(2-ethoxyethoxy)-1-phenylethyl] phenyl carbonate |
| SMILES | CCOCCOCC(OC(=O)Oc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H22O5/c1-2-21-13-14-22-15-18(16-9-5-3-6-10-16)24-19(20)23-17-11-7-4-8-12-17/h3-12,18H,2,13-15H2,1H3 |
| InChIKey | GCLGJJZZMQUGFT-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze [2-(2-ethoxyethoxy)-1-phenylethyl] phenyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-ethoxyethoxy)-1-phenylethyl] phenyl carbonate?
The IUPAC name of [2-(2-ethoxyethoxy)-1-phenylethyl] phenyl carbonate (CID 118088751) is [2-(2-ethoxyethoxy)-1-phenylethyl] phenyl carbonate.
What is the SMILES notation for [2-(2-ethoxyethoxy)-1-phenylethyl] phenyl carbonate?
The canonical SMILES for [2-(2-ethoxyethoxy)-1-phenylethyl] phenyl carbonate is CCOCCOCC(OC(=O)Oc1ccccc1)c1ccccc1.
What is the InChIKey of [2-(2-ethoxyethoxy)-1-phenylethyl] phenyl carbonate?
The InChIKey is GCLGJJZZMQUGFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22O5/c1-2-21-13-14-22-15-18(16-9-5-3-6-10-16)24-19(20)23-17-11-7-4-8-12-17/h3-12,18H,2,13-15H2,1H3.
What are the key properties of [2-(2-ethoxyethoxy)-1-phenylethyl] phenyl carbonate?
[2-(2-ethoxyethoxy)-1-phenylethyl] phenyl carbonate has a molecular weight of 330.38 g/mol, XLogP of 4.00, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-ethoxyethoxy)-1-phenylethyl] phenyl carbonate is sourced from PubChem (CID 118088751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).