About lithium;hydride;phenyl acetate
lithium;hydride;phenyl acetate (PubChem CID 173276859) has the molecular formula C8H9LiO2
and a molecular weight of 144.10 g/mol. Its IUPAC name is lithium;hydride;phenyl acetate.
Molecular Properties
| Compound Name | lithium;hydride;phenyl acetate |
| PubChem CID | 173276859 |
| Molecular Formula | C8H9LiO2 |
| Molecular Weight | 144.10 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | lithium;hydride;phenyl acetate |
| SMILES | CC(=O)Oc1ccccc1.[H-].[Li+] |
| InChI | InChI=1S/C8H8O2.Li.H/c1-7(9)10-8-5-3-2-4-6-8;;/h2-6H,1H3;;/q;+1;-1 |
| InChIKey | KHPSYHGQLLKILK-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.10 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze lithium;hydride;phenyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;hydride;phenyl acetate?
The IUPAC name of lithium;hydride;phenyl acetate (CID 173276859) is lithium;hydride;phenyl acetate.
What is the SMILES notation for lithium;hydride;phenyl acetate?
The canonical SMILES for lithium;hydride;phenyl acetate is CC(=O)Oc1ccccc1.[H-].[Li+].
What is the InChIKey of lithium;hydride;phenyl acetate?
The InChIKey is KHPSYHGQLLKILK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2.Li.H/c1-7(9)10-8-5-3-2-4-6-8;;/h2-6H,1H3;;/q;+1;-1.
What are the key properties of lithium;hydride;phenyl acetate?
lithium;hydride;phenyl acetate has a molecular weight of 144.10 g/mol, XLogP of -1.27, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;hydride;phenyl acetate is sourced from PubChem (CID 173276859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).